Concept explainers
For each compound. [1] Identify the
b.
d.
(a)
Interpretation:
The functional group / groups should be identified and the complete structure with lone pairs on hetero-atoms of the following compound should be drawn:
Concept Introduction:
Organic molecules have some structural features in addition to
This table gives information about the compounds containing
Type of Compound | General Structure |
Aldehyde | |
Ketone | |
Carboxylic acid | |
Ester | |
Amide |
Here, R = any carbon backbone
Complete structural formula of a molecule represents all the atoms of molecule, types of bonds connecting atoms and how atoms are connected to each other.
Answer to Problem 11.8PP
Functional group in the given compound is '
Explanation of Solution
The given compound is as follows:
The given compound can also be drawn as:
This compound contains a six membered ring and a
To draw the complete structure of the given skeletal structure, place carbon atom on each vertices and fulfill its valency with hydrogen atoms. Unlabelled vertex will represent carbon atom attached to number of hydrogen atoms required to fulfill its valency (i.e. four). Valence electron of oxygen is six. Out of six two electrons are used in making double bond with carbon atom. Then remaining four electrons will be available as lone pair.
So, complete structure of given compound is as follows:
(b)
Interpretation:
The functional group / groups should be identified and the complete structure with lone pairs on hetero-atoms of the following compound should be drawn:
Concept Introduction:
Organic molecules have some structural features in addition to
This table gives information about the compounds containing
Type of Compound | General Structure |
Aldehyde | |
Ketone | |
Carboxylic acid | |
Ester | |
Amide |
Here, R = any carbon backbone
Complete structural formula of a molecule represents all the atoms of molecule, types of bonds connecting atoms and how atoms are connected to each other.
Answer to Problem 11.8PP
Functional group in the given compound
Explanation of Solution
The given compound is as follows:
The above compound can be drawn as:
This compound contains four carbon and eight hydrogen atom with two oxygen atoms. The functional group is carboxylic acid containing an
To draw the complete structure of the given skeletal structure, place carbon atom on each vertices and fulfill its valency with hydrogen atoms. Unlabelled vertex will represent carbon atom attached to number of hydrogen atoms required to fulfill its valency (i.e. four). Valence electron of oxygen is six. Out of six two electrons of blue colored oxygen are used in making double bond with carbon atom. Then remaining four electrons will be available as lone pair.
Complete structure of the given compound is as follows:
(c)
Interpretation:
The functional group / groups should be identified and the complete structure with lone pairs on hetero-atoms of the following compound should be drawn:
Concept Introduction:
Organic molecules have some structural features in addition to
This table gives information about the compounds containing
Type of Compound | General Structure |
Aldehyde | |
Ketone | |
Carboxylic acid | |
Ester | |
Amide |
Here, R = any carbon backbone
Complete structural formula of a molecule represents all the atoms of molecule, types of bonds connecting atoms and how atoms are connected to each other.
Answer to Problem 11.8PP
Functional group in the given compound is 'ketone' and the complete structure of the compound is as follows:
Explanation of Solution
The given compound is as follows:
This compound contains six membered ring with one oxygen atom. The functional group is ketone containing a carbon-oxygen bond
To draw the complete structure of the given skeletal structure, place carbon atom on each vertices and fulfill its valency with hydrogen atoms. Unlabelled vertex will represent carbon atom attached to number of hydrogen atoms required to fulfill its valency (i.e. four). Valence electron of oxygen is six. Out of six two electrons of are used in making double bond with carbon atom. Then remaining four electrons will be available as lone pair.
Complete structure of the compound is as follows:
(d)
Interpretation:
The functional group / groups should be identified and the complete structure with lone pairs on hetero-atoms of the following compound should be drawn:
Concept Introduction:
Organic molecules have some structural features in addition to
This table gives information about the compounds containing
Type of Compound | General Structure |
Aldehyde | |
Ketone | |
Carboxylic acid | |
Ester | |
Amide |
Here, R = any carbon backbone
Complete structural formula of a molecule represents all the atoms of molecule, types of bonds connecting atoms and how atoms are connected to each other.
Answer to Problem 11.8PP
Functional group in the given compound is 'ester' and the complete structure of the compound is as follows:
Explanation of Solution
The given compound is as follows:
This given compound can be drawn as follows:
This compound contains an
To draw the complete structure of the given skeletal structure, place carbon atom on each vertices and fulfill its valency with hydrogen atoms. Unlabelled vertex will represent carbon atom attached to number of hydrogen atoms required to fulfill its valency (i.e. four).
Valence electron of oxygen is six. Out of six two electrons of blue colored oxygen are used in making double bond with carbon atom. Then remaining four electrons will be available as lone pair. For pink colored oxygen atom, one electron is used in making bond with carbonyl carbon atom and another electron is used in making bond with carbon backbone. Then remaining four will be present as lone pair.
The complete structure of the given compound is as follows:
(e)
Interpretation:
The functional group / groups should be identified and the complete structure with lone pairs on hetero-atoms of the following compound should be drawn:
Concept Introduction:
Organic molecules have some structural features in addition to
This table gives information about the compounds containing
Type of Compound | General Structure |
Aldehyde | |
Ketone | |
Carboxylic acid | |
Ester | |
Amide |
Here, R = any carbon backbone
Complete structural formula of a molecule represents all the atoms of molecule, types of bonds connecting atoms and how atoms are connected to each other.
Answer to Problem 11.8PP
Functional group in the given compound is an 'amide' and the complete structure of the compound is as follows:
Explanation of Solution
The given compound is as follows:
This compound contains an
To draw the complete structure of the given skeletal structure, place carbon atom on each vertices and fulfill its valency with hydrogen atoms. Unlabelled vertex will represent carbon atom attached to number of hydrogen atoms required to fulfill its valency (i.e. four).
Valence electron of oxygen is six. Out of six two electrons of oxygen atom are used in making double bond with carbon atom. Then remaining four electrons will be available as lone pair. Valence electron of nitrogen is five. Out of five, one electron is used in making bond with the carbonyl carbon atom, one electron is used in making bond with
The complete structure of the given compound is as follows:
Want to see more full solutions like this?
Chapter 11 Solutions
General, Organic, and Biological Chemistry - 4th edition
- Fill in all H's and lone pairs in each compound. b. c--c а. С—С—с—С С. С —С—С d. C-Ĉ-N-C е.arrow_forwardConvert each shorthand structure to a complete structure with all atoms and lone pairs drawn in. a. (CH3)2CH(CH,),CH3 b. (CH3)3COH c. CH;CO2(CH2)3CH3 ÇI CI d. HO OCH(CH3)2arrow_forwardConvert each condensed formula to a Lewis structure.1.) (CH3)2CHOCH2CH2CH2OH2.) CH3(CH2)2CO2C(CH3)3arrow_forward
- Which of the following compounds is a valid Lewis structure of a hydrocarbon? H H-C-Ö-H H HH H-C-N-H H I II H H-C-C-H H III HH H-C-C-H I НН IV I, II, and IV are valid structures of hydrocarbons. Only III is a valid structure of hydrocarbons. All of these compounds are valid structures of hydrocarbons. Only IV is a valid structure of hydrocarbons. III and IV are valid structures of hydrocarbons.arrow_forwardConvert each molecule into a skeletal structure. a. (CH3)½CHCH,CH2CH(CH3)2 c. CH3(CH2)½C(CH3)½CH(CH3)CH(CH3)CH(Br)CH3 нн HT TH ċ-C H CH3 c-c CH2 b. CH;CH(CI)CH(OH)CH3 d. CH3-C H limonene (oil of lemon)arrow_forwardV. Give what is asked. 1. When 2 carbon atoms form a double bond, how many pairs of e- will be shared between them? 2. An alkane has 5 carbon atoms. How many hydrogen atoms will it have? 3. An alkene has 3 carbon atoms. How many hydrogen atoms will it have? 4. An alkyne has 4 carbon atoms. How many hydrogen atoms will it have? 5. Show the Lewis structure for the stable molecule CH3.arrow_forward
- B. Cycloalkanes 1) Construct a model of the cyclic alkane: cyclopentane (C5H₁0). Because the five carbon atoms are locked in a ring, rotation about the single bonds is restricted; the plane of the ring a fixed geometry within the molecule. Toggle between full Lewis structures and skeletal structures by clicking the C-H tool. Model 1: Use the solid wedge tool to attach a methyl group to each of two different carbon atoms in the cyclopentane. Note the five carbons of the ring are in the plane of the paper, and the solid wedge indicates both methyls project forward, in front of the plane of the paper. Model 2: Use the solid wedge tool to attach first methyl group to one of two different carbon atoms in the cyclopentane, and use the dashed wedge tool to attach the second. Note the solid wedge indicates that one methyl projects forward, in front of the plane of the paper. The dashed wedge indicates the other methyl extends back, behind the plane of the paper. Click the broom to tidy up the…arrow_forwardConvert each condensed formula to a complete structure with lone pairs on heteroatoms. a. CH 3(CH 2) 8CH 3 c. CH 3CCl 3 e. (CH 3) 2CHCH 2NH 2 b. CH 3(CH 2) 4OH d. CH 3(CH 2) 4CH(CH 3) 2arrow_forwardConvert each molecule to a skeletal structure. a. (CH3)2CHCH2CH2CH(CH3)2 b. CH3CH(Cl)CH(OH)CH3 c.CH3(CH2)2C(CH3)2CH(CH3)CH(CH3)CH(Br)CH3arrow_forward
- 1. Write all the possible: a. Skeletal isomers with molecular formula, C,H16- b. Positional isomers with molecular formula, C,H „Br. c. Functional isomers with molecular formula, C,H,O,. d. Cis and trans isomer of CH,CH,CH,CH=CHCH,CH;. CH3 c. E and Z isomers of CH3CH;CH=CCH;CH,CH,arrow_forwardConvert the following condensed formulas into skeletal structures. a. CH3CONHCH3 b. CH3COCH2Br c. (CH3)COH d. CH3COCl e. CH3COCH2CO2H f. HO2CCH(OH)CO2Harrow_forwardLine-bond structures appear to imply that there are two different isomers of 1,2-dibromobenzene, one with the bromine-bearing carbon atoms joined by a double bond and one with the bromine-bearing carbons joined by a single bond. In fact, though, there is only one 1,2-dibromobenzene. Explain. H H. C. Br H. .C. Br || || .C and 1,2-Dibromobenzene Br Brarrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistryChemistryISBN:9781259911156Author:Raymond Chang Dr., Jason Overby ProfessorPublisher:McGraw-Hill EducationPrinciples of Instrumental AnalysisChemistryISBN:9781305577213Author:Douglas A. Skoog, F. James Holler, Stanley R. CrouchPublisher:Cengage Learning
- Organic ChemistryChemistryISBN:9780078021558Author:Janice Gorzynski Smith Dr.Publisher:McGraw-Hill EducationChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningElementary Principles of Chemical Processes, Bind...ChemistryISBN:9781118431221Author:Richard M. Felder, Ronald W. Rousseau, Lisa G. BullardPublisher:WILEY