Enter electrons as e¯. Use smallest possible integer coefficients. If a box is not needed, leave it blank. A voltaic cell is constructed from a standard Co²+ | Co half cell (E° red = -0.280V) and a standard Mg2+ | Mg half cell (E°red = -2.370V). The anode reaction is: + The cathode reaction is: → + The spontaneous cell reaction is: + The cell voltage is V. ↑ +

Enter electrons as e¯. Use smallest possible integer coefficients. If a box is not needed, leave it blank. A voltaic cell is constructed from a standard Co²+ | Co half cell (E° red = -0.280V) and a standard Mg2+ | Mg half cell (E°red = -2.370V). The anode reaction is: + The cathode reaction is: → + The spontaneous cell reaction is: + The cell voltage is V. ↑ +

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 5QRT: Identify each statement as true or false. Rewrite each false statement to make it true. (a)...

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Identify each statement as true or false. Rewrite each false statement to make it true. (a) Oxidation always occurs at the anode of an electrochemical cell. (b) The anode of a discharging voltaic cell is the site ofreduction and is negative. (c) Standard-state conditions for electrochemical cells are aconcentration of 1.0 M for dissolved species and a pressure of 1 bar for gases. (d) The potential of a voltaic cell does not change withtemperature. (e) All product-favored oxidation-reduction reactions have astandard cell potential Ecell, with a negative sign.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.