17.39 Using ethanol as the source of all the carbon atoms, describe efficient syntheses of each of the following, using any necessary organic or inorganic reagents: (c) (d) ა C 17.39 Using ethanol as the source of all the carbon atoms, describe efficient syntheses of each of the following, using any necessary organic or inorganic reagents: (d) CH3CHC CH OH
Q: Draw all secondary resonance structures for benzaldehyde. a. Is the aldehyde group electron donating…
A: Approach to solving the question: Detailed explanation:Since -CHO is an EWG, it decreases the…
Q: The following molecular ion isotopic clusters correspond to derivatives of benzene (C6H6) for which…
A: Step 1: Step 2: Step 3: Step 4:
Q: The correct lewis structure fir carbonate acid H2CO3
A: Step 1: Step 2: Step 3: Step 4:
Q: Based on your ICE table (Part 2) and the definition of Ka, set up the expression for Ka in order to…
A: BCA TABLE:Step 1: Calculate the number of moles (mol) of HClO and NaClO by multiplying the…
Q: None
A:
Q: None
A:
Q: None
A: Step 1:(a) To calculate the solubility-product constant (Ksp) for Pb(IO3)2, we use the…
Q: Polymers may be composed of thousands of monomers. Draw three repeat units (trimer) of the polymer…
A:
Q: Give the major organic product(s) 4. CH3 HBr CH3
A: The objective of the question is to determine the major organic product(s) when CH3 (Methane) is…
Q: Can you please answer this question with steps. Thanks.
A: The objective of the first part of the question is to determine which ligand, X or Y, is the…
Q: Calculate the volume in milliliters of a 0.75M barium acetate solution that contains 150 mmol of…
A: The objective of the question is to find the volume of a 0.75M barium acetate solution that contains…
Q: Decide whether each of the molecules in the table below is stable, in the exact form in which it is…
A: Step 1: Step 2: Step 3: Step 4:
Q: The beautiful expert Hand written solution is not allowed.
A: Now ∆G = - RTlnK = - nFE⁰cellThus E⁰cell = RT lnK / nF = [8.314 × 298 × ln (5.65 ×…
Q: Predict the product of the following reaction: Cl₂, H HỌ CH3 C1 OH xi
A: Hence, option A is correct
Q: The correct lewis structure fir carbonate acid H2CO3
A: Thank you.
Q: For the following structure, identify the spatial relationship between two or more hydrogens that…
A: Step 1: Step 2: Step 3: Step 4:
Q: 4. Using the Woodward-Fieser rules estimate the expected max for the following compound: 5. By…
A: Step :
Q: 3) Venlafaxine is a Wyeth antidepressant that is synthesized on a commercial scale from the starting…
A: Step 1:
Q: dont provide handwriting solution ...
A: The objective of this question is to find the pressure of helium in the balloon when the temperature…
Q: In industry, ethanol is produced from the hydration of ethylene. Calculate the value of the…
A: Here is the detailed explanation:Don't forget to leave a helpful rating.Thank you and happy learning…
Q: help 11
A: This reaction is an Acid-Catalyzed Ester Hydrolysis in which a compound produce its corresponding…
Q: Aqueous sulfuric acid (H_{2}*S*O_{4}) reacts with solid sodium hydroxide (NaOH) to produce aqueous…
A: The objective of this question is to calculate the percent yield of sodium sulfate in a chemical…
Q: List two possible steps in the procedure that might've led to the gain and impurities to appear to…
A: The objective of this question is to identify two possible steps in a cycle of reactions involving…
Q: S.a.g.a.r.
A: The objective of the question is to plot the concentration of the protonated form (HA) and the…
Q: At a particular temperature, K = 7.3 x 10-6 for the following balanced reaction: 2N2O3 (9) + O2(g) →…
A: The objective of the question is to find the equilibrium concentrations of all gases in the given…
Q: An aqueous solution contains 0.25 M HF and 0.20 M NaF . The pKa for HF is 3.45. What is the pH of…
A: The objective of this question is to calculate the pH of an aqueous solution containing 0.25 M HF…
Q: a chemist adds 110.0 of a 1.63 mol / L calcium bromide (CaBr 2 ) solution to a reaction…
A: The objective of this question is to calculate the mass of calcium bromide (CaBr2) that has been…
Q: 19.73 Propose an efficient synthesis for each of the following transformations: (a) 0-0 (b) (c) Br -
A: Step 1:a) The product is synthesized from the starting material by using the two-step reaction…
Q: Draw the mechanism arrows for the reaction between an acid chloride and an alcohol.
A:
Q: Suppose you are told that the following reaction was a substitution reaction but are not told the…
A: do leave a thumbs-up, as it motivates us to assist you better and faster. Thank You..
Q: help 12
A: Step 1: The hydroxide ion (OH-) from LiOH attacks the carbonyl carbon atom of the starting ester…
Q: An unknown substance has a mass of 0.125 kg and an initial temperature of 91.5°C. The substance is…
A: The objective of this question is to calculate the specific heat of an unknown substance using the…
Q: Part D bile, 8.8 x 10-6 M Express your answer to two significant figures and include the appropriate…
A:
Q: e skill 17.18 Propose an efficient synthesis for each of the following transformations: (a) (c) (e)…
A: Step 1: Step 2: Step 3: Step 4:
Q: Provide the reagents and solvents necessary to perform the indicated transformation. More than one…
A: Step 1: Step 2: Step 3: Step 4:
Q: For the next compounds/ions, draw two (2) appropriate Lewis structures. One structure must obey the…
A: Lewis structures represent atoms by showing how they share electrons when they form a molecule.…
Q: identify the instructor - prepared maltrose as a - D - maltrose or B - D - maltrose. Describe the…
A: Maltose (malt sugar) is a disaccharide formed from two units of glucose joined with an α(1→4) bond.…
Q: Use the activities to calculate the molar solubility of Zn(OH)2 in 0.0167M K2SO4. What is the…
A: Step 1: Step 2: Step 3: Step 4:
Q: Answer step 1 step 2 step 3
A: Step 1:Calculate the total cost associated with purchasing the land: Cost of land = Purchase price…
Q: Using the rules of aromacy determine if the following compounds A,B,C are aromatic and explain why
A: Step 1: For any compound to be aromatic it should follow huckel's rule - 1. The compound must…
Q: Predict the expected product. 1) LiAlHy 2) H₂O
A:
Q: 20. Draw the line-angle formulas for the products from the hydrolysis of each of the following: a. +…
A: Step 1: The given reaction follows base-catalyzed hydrolysis of amides. In base-catalyzed hydrolysis…
Q: Predicting qualitatively how entropy changes with mixing and separation 1/3 For each system listed…
A: Step 1: Step 2: Step 3: Step 4:
Q: The base protonation constant K of allantoin (C4H4NO3NH2) is 9.12 × 106. Calculate the pH of a 0.44…
A: Step 1: Step 2: Step 3: Step 4:
Q: b). What is the conjugate base of NH4? c) The Ka for NH4* is 5.5x10-10. What is the pKa for its…
A: b) Conjugate base is formed when a species releases a proton (H+).NH4+ →−H+ NH3so, conjugate base of…
Q: None
A: a) This molecule has two functional groups, the C=O i.e. ketone and the methyl CH3 group.b) This…
Q: Cations Which of the following is considered a cation? Na+ CI- CI Na
A: Step 1: SolutionThe cation is -----> Na+ Explanation: we know that the chemical ions with a…
Q: Calculate the volume in of a 0.606M copper(II) sulfate solution that contains 500. mmol of copper 2…
A: The objective of this question is to calculate the volume of a 0.606M copper(II) sulfate solution…
Q: Assume that each compound in the drug mixture would make a spot on the paper the same size as those…
A: Step 1: No, it's unlikely that paper chromatography would be sufficient to separate all the…
Q: Conjugate base acid Iso-Butyronitrile pka_ → 1) Consider the reaction AH(+) + H₂O A:+H3O+. For the…
A: Iso-ButyronitrileStructure of acid: CH3−CH(CH3)−CN.pKa of conjugate acid: 25Name of conjugate…
Step by step
Solved in 2 steps
- Predict the products of the following acid-base reactions. If the equilibrium would not result in the formation of appreciable amounts of products, you should so indicate. In each case label the stronger acid, the stronger base, the weaker acid, and the weaker base: (a) CH3CH=CH2 + NANH2 (d) CH3C=C: + CH;CH2OH → (e) CH3C=C:- + NH¾CI – | (b) CH;C=CH + NaNH2 (c) CH3CH2CH3 + NANH2 → | HASArrange the alkenes in each set in order of increasing rate of reaction with HI and explain the basis for your ranking. Draw the structural formula of the major product formed in each case. (a) and (b) H3CH₂CHC=CH₂ and (H3C) 2C=CHCH3Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents used (both the alcohol and the aldehyde are of interest for their antimicrobial properties, while the acid is used to treat type II hyperammonemia): A (a) (b) (c) CoH,CH,CHO phenylethanal B C6H5CH₂CH₂OHC₂H₂CH₂CO₂H phenylethanol Suggest reagents (shown as A and B in the scheme above) that could be used to carry out the oxidation of the alcohol to the aldehyde and the acid, respectively. C6H5CH₂- Suggest two other syntheses of phenylethanoic acid, in each case indicating the starting materials and other reagents required, but not giving details of mechanism. One of your proposed syntheses must start with a compound which only contains seven carbon atoms (the acid product contains eight carbon atoms). phenylethanoic acid Phenylethanal can be converted to a hydrate in the presence of aqueous acid, though the position of equilibrium is very far to the left: H H+/H₂O OH C6H5CH₂-C-H OH Explain why…
- 17.39 Using ethanol as the source of all the carbon atoms, describe efficient syntheses of each of the following, using any necessary organic or inorganic reagents: (c) O (d) CH3CHC=CH OH15.20 Give structural formulas for the intermediates and products indicated by letters in the following equations. O -11-981₁ (a) CH₂-CHCH=CHCOH LIAIH, diethyl ether H₂O →A 2 CH₂CH₂MgBr (b) CH₂CH₂CH₂CH₂COCH₂CH, diethyl ether C H CrO,CI dichloromethane NHẠC H₂O D BDimethyl disulfide, CH,S–SCH3, found in the vaginal secretions of female hamsters, acts as a sexual attractant for the male hamster. Write an equation for its synthesis from methanethiol.
- (a) Give an acceptable name for compound A. (b) Draw the organic products formed when A is treated with each reagent: [1] H3O+; [2] −OH, H2O; [3] CH3CH2CH2MgBr (excess), then H2O; [4] LiAlH4, then H2O.(i) State reagents G and J. (ii) Draw the structural formula for compounds D, E and H.17.39 Using ethanol as the source of all the carbon atoms, describe efficient syntheses of each of the following, using any necessary organic or inorganic reagents: (a) CH3CH(OCH2CH3)2 (b) H CH3
- An alkene is treated with OsO4 followed by H2O2. When the resulting diol is treated with HIO4, the only product obtained is an unsubstituted cyclic ketone with molecular formula C6H10O. What is the structure of the alkene?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?