Answered: What is the pH when 10 mL of a 0.15 M…

Science

Chemistry

What is the pH when 10 mL of a 0.15 M NaOH solution is added to 25 mL of a 0.1 M solution of benzoic acid (pKa = 4.20)?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter13: Acids And Bases

Section: Chapter Questions

Problem 31QAP: What is the pH of a solution obtained by adding 13.0 g of NaOH to 795 mL of a 0.200 M solution of...

See similar textbooks

Related questions

Q: Question 17

Q: 17. Which ion is not isoelectronic with the others? a) N³- b) 02- c) Ne d) A1²+ e) Mg2+

A: The objective of the question is to identify the ion that is not isoelectronic with the others.…

Q: Calculate the density of oxygen gas (in g/L) at 477 mm Hg and 45.8 °C.g/L

A: The objective of this question is to calculate the density of oxygen gas under given conditions of…

Q: Calculate AGO for each of the following reactions from the equilibrium constant at the temperature…

A: (a)(b)(c)(d)(e)(f)ReactionsN2(g)+O2(g)→2NO(g)H2(g)+I2(g)→HI(g)CO2(g)+H2(g)→CO(g)+H2O(g)C…

Q: A sample of neon gas at a pressure of 0.561 atm and a temperature of 24.8 °C, occupies a volume of…

A: The objective of the question is to find the pressure of a sample of neon gas after it is compressed…

Q: Questions 1) Consider the two reactions below. 1) NaOH 2) Reaction A H 요요 H 3) H3O+ Reaction B H 1)…

A: Step 1:a) To draw the major products of each reaction:Reaction A:NaOH is a strong base and would…

Q: No hand writing pleaseMechanism

A: Step 1:The oxidation of benzoin to benzil by sodium hypochlorite (NaOCl). This type of reaction…

Q: 5) Of the following, the entropy of gaseous is the largest at 25 °C and 1 atm. A) C2H2 B) H₂ C) C2H6…

A: Step 1:Entropy is a measure of system's disorderliness or randomness. In more microstates system can…

Q: Draw estrogen and testosterone. Number the positions of the core steroid nucleus NO AI

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Step 1:

Q: 1. CN Br 2. LiAlH4 3. H₂O NH2 2a Primary amines can be prepared from nitriles by reduction with…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: Calculate the energy required to heat 143.0 g of mercury from -3.2 °C to 2.7 °C. Assume the specific…

A: Step 1: Given - Initial temperature Ti = -3.20C = -3.2 +273 = 269.8 K Final temperature Tf =…

Q: how to get 1-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone from…

A: Step 1:Here's a proposed synthetic pathway along with the mechanism for each…

Q: HO H H H2504 X=Y

A: Note : Aldehydes are more reactive than ketones . ketones are less reactive due to bulkiness and…

Q: 3+ 2+ For the reaction 2Ga (aq) + 3Zn(s) → 2Ga(s) + 3Zn (aq)E° = 0.21V Determine the 3+ value of E °…

A: To determine the reduction potential (E°red) for the Ga3+/Ga half-cell from the given overall…

Q: ANSWER IN kJ!!!!!! Careful with sig figs

A: Step 1:Step 2:

Q: Zn + HgO → ZnO + Hg How many g of Hg (200.59 g/mol) will be produced in 30 days if the current…

A: Step 1: Calculating the amount of charge generated in 30days…

Q: In thermodynamic of the dissolution of Borax lab, the student's graph is below. Calculate AS? (R=…

A: A linear regression of lnKsp vs 1/T graph gives a straight line. Through this, we can get…

Q: Write the equation for the other half-reaction, called the dark reaction, for photosynthesis .…

A: The objective of the question is to write the chemical equation for the dark reaction, also known as…

Q: Determine the temperature of a reaction if K = 1.2 x 10⁻⁶ when ∆G° = +18.1 kJ/mol.

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: What is the mechanism and reagents for this reaction? with the circled molecule being attacked first…

A: Step 1: Step 2: Step 3: Step 4:

Q: Which statement is false about the resonance structure? Water molecule has one Lewis structure…

A: False statement: Resonance structures of the same molecule have different total of electrons. True…

Q: Choose all correct comments about the shown reaction below. O, H O H HO HO HO X H-OH H-OH H- -OH -OH…

A: Step 1: The carbonyl double bond (-C=O) in the upper portion of the molecule will be opened forming…

Q: A 9.09-L sample of gas has a pressure of 0.583 atm and a temperature of 78 °C. The sample is allowed…

A: The objective of this question is to calculate the new pressure of the gas after it has been allowed…

Q: None

A: Generally P exhibits valence 3, sulfur and oxygen exhibit valence 2. Among the given structures…

Q: None

A: Spectroscopic Techniques for Isotope Analysis of Helium: Introduction to Spectroscopy-Spectroscopy…

Q: Calculate and balance of equations that show how the substance dissolves in water.

A: The objective of the question is to balance the equations that show how the given substances…

Q: Indicate the major product of the following reaction, drawing the intermediate products if any. H3CO…

A: Step 1: Step 2: Step 3: Step 4:

Q: Explain why a solution of ammonium nitrate is a weak acid. Give a balanced rection equation…

A: The objective of the question is to explain why a solution of ammonium nitrate behaves as a weak…

Q: A mixture of 2 mL of 3 M NaOH solution, 2.5 mL 95% ethanol, 0.212 g benzaldehyde, and 0.058 g…

A: The reaction is the Aldol condensation, 2C6H5CHO+CH3COCH3→C6H5CH=CHC(O)CH=C6H5+2H2Owhere…

Q: Please describe the mechanism in words for the reaction below. DO NOT provide a mechainism.

A: The question is asking to describe the mechanism of Jones' Oxidation Test for Secondary and Primary…

Q: In the reaction, sodium and chlorine combine to produce sodium chloride. In an instance when four…

A: Step 1:In the reaction, 2Na + Cl2 → ? NaClFirst balance the reaction, 2Na + Cl2 → 2 NaCl In the…

Q: 9

A: This reaction is called diazo-coupling reaction In this reaction, benzene diazonium ions are weak…

Q: Explain why the 2s and 2p energy levels are at the same energy for Li+2.

A: In the lithium ion Li²+, the 2s and 2p orbitals become degenerate (have the same energy). This…

Q: Which of the following gas samples would have the largest volume, if all samples are at the same…

A: The objective of the question is to determine which of the given gas samples would occupy the…

Q: A 1.44-g sample of an unknown gas has a volume of 896 mL and a pressure of 742 mm Hg at 37.9 °C.…

A: The objective of this question is to calculate the molar mass of an unknown gas given its mass,…

Q: A sample of krypton gas at a pressure of 1.12 atm and a temperature of 28.5 °C, occupies a volume of…

A: The objective of the question is to find the pressure of a sample of krypton gas after it is allowed…

Q: Choose the characteristic that is NOT TRUE of equilibrium expressions. Products generally appear in…

A: The objective of the question is to identify the statement that is not true about equilibrium…

Q: You are required to use commercially available Caffeine Tablet to obtain caffeine for your…

A: The objective of the question is to determine the number of caffeine tablets needed to compound 10…

Q: please answer in text form and in proper format answer with must explanation , calculation for each…

A: Given:…

Q: Propose a step-by-step, detailed mechanism for the reaction depicted H3O+ HO

Q: Solve.

Q: Help me categorize this

A: 1. Used for measuring/dispensing accurate volume:10 mL Graduated cylinder: This cylinder has…

Q: Draw the structure(s) of the major organic product(s) of the following reaction. • • 1. in…

A: First one is the product. But due to the presence of acid, the ester undergoes hydrolysis to give…

Q: P13.5: The biosynthetic pathway for the antibiotic compound rabelomycin begins with the condensation…

A: Step 1: Step 2: Step 3: Step 4:

Q: Part 3 (3 pts each) 1) Write the balanced molecular, total ionic, and net ionic equation for the…

A: The objective of the question is to write the balanced molecular, total ionic, and net ionic…

Q: A sample of He gas has a volume of 565 mL, has a pressure of 984 mm Hg, and is at a temperature of…

A: The objective of this question is to calculate the amount of helium (He) gas in moles given the…

Q: Indicate whether (a) and (b) are radial nodes or nodal planes: a 2s (a) is a (b) is a > < b 2PX

A: The objective of the question is to determine whether the given atomic orbitals (2s and 2px) have…

Q: Please answer in typing format

A: Let's see all the molecular weight.Here molecular ion peak is 101. So answer is amine.

Q: f 15.0 g S8 (molar mass = 256.56 g/mol) is made to react with 2.0 L O2 at 30 oC and 1.0 atm, what is…

A: Reaction involved is :-S8(s) + 12O2(g) -> 8SO3 (g) Given mass of S8 = 15.0 gMolar mass of S8 =…

Question

What is the pH when 10 mL of a 0.15 M NaOH solution is added to 25 mL of a 0.1 M solution of benzoic acid (pKa = 4.20)?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Estimate the pH that results when the following two solutions are mixed. a) 50 mL of 0.3 M CH3COOH and 50 mL of 0.4 M KOH b) 100 mL of 0.3 M CH3COOH and 50 mL of 0.4 M NaOH c) 150 mL of 0.3 M CH3COOH and 100 mL of 0.3 M Ba(OH)2 d) 200 mL of 0.3 M CH3COOH and 100 mL of 0.3 M Ba(OH)2
For conjugate acidbase pairs, how are Ka and Kb related? Consider the reaction of acetic acid in water CH3CO2H(aq)+H2O(l)CH3CO2(aq)+H3O+(aq) where Ka = 1.8 105 a. Which two bases are competing for the proton? b. Which is the stronger base? c. In light of your answer to part b. why do we classify the acetate ion (CH3CO2) as a weak base? Use an appropriate reaction to justify your answer. In general, as base strength increases, conjugate acid strength decreases. Explain why the conjugate acid of the weak base NH3 is a weak acid. To summarize, the conjugate base of a weak acid is a weak base and the conjugate acid of a weak base is a weak acid (weak gives you weak). Assuming Ka for a monoprotic strong acid is 1 106, calculate Kb for the conjugate base of this strong acid. Why do conjugate bases of strong acids have no basic properties in water? List the conjugate bases of the six common strong acids. To tie it all together, some instructors have students think of Li+, K+, Rb+, Cs+, Ca2+, Sr2+, and Ba2+ as the conjugate acids of the strong bases LiOH, KOH. RbOH, CsOH, Ca(OH)2, Sr(OH)2, and Ba(OH)2. Although not technically correct, the conjugate acid strength of these cations is similar to the conjugate base strength of the strong acids. That is, these cations have no acidic properties in water; similarly, the conjugate bases of strong acids have no basic properties (strong gives you worthless). Fill in the blanks with the correct response. The conjugate base of a weak acid is a_____base. The conjugate acid of a weak base is a_____acid. The conjugate base of a strong acid is a_____base. The conjugate acid of a strong base is a_____ acid. (Hint: Weak gives you weak and strong gives you worthless.)
Using the diagrams shown in Problem 10-117, which of the solutions would have the greatest buffer capacity, that is, greatest protection against pH change, when the following occurs? a. A strong acid is added to the solution. b. A strong base is added to the solution.
What is the pH of a solution that consists of 0.20 M ammonia, NH3, and 0.20 M ammonium chloride, NH4Cl?
Does the pH of the solution increase, decrease, or stay the same when you (a) Add solid sodium oxalate, Na2C2O4, to 50.0 mL of 0.015-M oxalic acid? (b) Add solid ammonium chloride to 100. mL of 0.016-M HCl? (c) Add 20.0 g NaCl to 1.0 L of 0.012-M sodium acetate, NaCH3COO?
Given the acid-base indicators in Question 37, select a suitable indicator for the following titrations. (a) sodium formate (NaCHO2) with HNO3 (b) hypochlorous acid with barium hydroxide (c) nitric acid with HI (d) hydrochloric acid with ammonia
What is the pH of a solution obtained by adding 13.0 g of NaOH to 795 mL of a 0.200 M solution of Sr(OH)2? Assume no volume change after NaOH is added.
What are the pH and ion concentrations in a solution of 0.10 M sodium formate, NaCHO2? Kb for the formate ion, HCO2 is 5.6 1011. pH [Na+] [CHO2] [OH] (a) 5.63 0.10 0.10 2.4 10-6 (b) 837 0.10 0.10 2.4 10 6 (c) 822 0.050 0.050 17 10- (d) 5.63 0.10 0.10 42 10
When 25.00 mL of 0.467 M NaOH was added to 50.00 mL of a 0.467 M solution of a weak acid, HX, the pH of the mixture reached a value of 3.49. What is the Ka of the weak acid? Ka=
What is the pH value of the final solution when 50 mL of a 0.5 M NaOH solution is added to 50 mL of a 3M acetic acid solution (pKa=4.76)?
What is the pH of a solution made by adding 5.0 mL of 0.80 M NaOH to a 10.0 mL solution of 1.0 M acetic acid? Given pKa = 4.74
4-(N-Morpholino)butanesulfonic acid (MOBS) is a weak acid used to prepare buffers for biological samples through combination with strong bases. How many mL of 0.626 M KOH should be added to 5.00g of MOBS (pKa=7.48 and formula mass is 223.29 g/mol) to give a pH of 7.40