In an experiment, 110.0 g of iron is combined with 95.0 g of oxygen gas to create iron (III) oxide. If you have 30.0 g of iron (III) oxide at the end, calculate its percentage yield. Organize all your work, starting with the BCE.

In an experiment, 110.0 g of iron is combined with 95.0 g of oxygen gas to create iron (III) oxide. If you have 30.0 g of iron (III) oxide at the end, calculate its percentage yield. Organize all your work, starting with the BCE.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 94QAP: A 100.0-g mixture made up of NaCl03, Na2CO3, NaCl, and NaHCO3 is heated, producing 5.95 g of oxygen,...

See similar textbooks

Related questions

Q: If 4.0 g of sodium iodide and 4.0 g of chlorine gas react, what are the theoretical yields of both…

Q: Start with condensed structural formula CH3-CH(OH)-CH(CH3)-CH2-C(CH3)3 and react it first with H₂SO4…

A: Alkene hydrogenation occurs at a temperature of around 150°C, the reaction takes place in the…

Q: Write the formula for the following set of ions: Al3+, F1-

Q: 17.A solid piece of limestone (calcium carbonate) is reacted with 1.0 mol/L sulfuric acid at 25 °C.…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Draw a structure for the following compound: 2-Heptyne Draw a structure for the following compound:…

Q: A bubble of helium gas has a volume of 0.650 mL near the bottom of a large aquarium where the…

Q: i) What is K for this redox reaction? ii) Is this reaction likely to occur? iii) Is the reaction…

Q: The Lewis Dot Structure rule states that S=N-A. Recall that S represents the TOTAL number of valence…

A: The Lewis Dot Structure rule states that S=N-A. Recall that S represents the TOTAL number of valence…

Q: Electrophoresis at pH 7.0 of the following lipid mixture is perfo lipid mixture…

Q: Jisoo was asked to prepare a 50.0ml solution containing 5.00g of CuCl₂ for the class. However, she…

Q: 22. The trial ion product, Q, when compared to the Solubility Product Constant, K., will indicate if…

A: 22. The trial ion product, Q. when compared to the Solubility Product Constant, K sp. will…

Q: Consider the following reaction: CO(g) + 3H2 (g) ⇌ CH4 (g) If Kc = 3.46 What is Kc for the…

A: If the equilibrium reaction is reversed then the equilibrium constant of the reversed reaction will…

Q: 4. Write the product and the mechanism for reaction. Write the names of starting material and…

Q: Which of the following is the best HBA? a) b) c) d) R-C Els er de de R-P R-N OH XR Ob) Od d) O=

A: Hydrogen bond is formed between hydrogen bond donor and hydrogen bond acceptor.

Q: Calculate the molarity of 28.0% ammonia if you know that its specific gravity is 0.898 and that the…

A: 28.0 % ammonia has a specific gravity of 0.898 .We have to calculate the molarity of the ammonia…

Q: 2. Write the product and the mechanism for reaction. Write the names of starting material and…

A: According to Markovnikov's rule, when Hydrogen halide is added with alkene , then negative part…

Q: 7. Explain how the molar conductivities can be used to generate plots to determine the acid…

A: To get the acid dissociation constant, plot a graph between reciprocal of concentration of acetic…

Q: The electron in a Bohr hydrogen atom is bound less tightly when it has a quantum number of 3 than…

Q: is the A:B ratio just a place holder for the unknown compound can you use other variables in place…

A: Answer: This question is based on the fundamentals of crystal structure, where different type of…

Q: arch projec e a compara mical equat

A: Inert atmosphere will be created using nitrogen or helium.

Q: Determine the total hardness as ppm CaCO3 of a sample of water that has calcium content of 56 mg/L…

A: We have to find the total hardness as ppm (mg/L) CaCO3 of a sample of water. Given - Calcium content…

Q: What reagents are required to convert the alkene 1-butene to the haloalkane 2- bromobutane? A) H₂O,…

Q: A 50.0g sample of Ba(OH)2 xH₂O(s) contains 27.2g of Ba(OH)2. Calculate the value of x for this…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: An enzymatic reaction is run in 5.00 mL of 10.0 mM TRIS-HCl buffer at pH 7.82. If during the course…

A: Given the initial pH of the buffer = 7.82 Ka of TRIS-HCl = 8.32*10-9 Final pH after reaction =…

Q: Carbon dioxide in high levels can cause death. One method of removing carbon dioxide from the air of…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: how many ml of 0.100 m naoh is needed to dilute to a given 2.00litre of 0.0500 m naoh A 100ml B 50ml…

A: • The values provided in the q uestion are:- i) Initial concentration of NaOH solution, M1 =…

Q: Chemistry Please answer A and B of the Following question and provide the Name for B too. Predict…

A: The solutions are given below -

Q: What is the mass, in grams, of exactly 230 sodium atoms? Would it be the same answer only in grams?…

A: Steps to convert atoms to grams • Convert atoms to moles - Divide the number of atoms with Avogadro…

Q: A 0.137 mol of N^2O gas occupies a volume of 846mL at a pressure at 2.37 atm. What temperature is…

Q: where does 0.5116 and 1.0074466?

A: The pH of a solution is determined by the Henderson-Hasselbalch equation. It is used to calculate…

Q: Match: 1. An atom's mass number mathematically equals 2. The total number of electrons in a(24Cr+³…

A: Here we are required to match the statement in column A and column B.

Q: 5) Predict the direction of the entropy change in each of the following reactions (i.e. write either…

A: Entropy is measure of randomness of the particle / molecule or substance.

Q: which of the following isomers will be converted to salt a more rapidly quaternary N(CH3)₂ ~N(CH3)2…

Q: 9. Determine whether the following drugs comply with Lipinski's rule. Also investigate the…

A: Lipiniski rule States --> 1.Not more than 5 hydrogen bond donars. 2. Not more than 10 H bonding…

Q: 4 55 56 57 Cs Ba La 112.9055 137.34 138.9055 88 89 Fr Ra Ac (223) 226.02.54 Select one: O a. Cs > K>…

A: We know that the atomic size increases in a group when we move from top to bottom. Thus the energy…

Q: Describe the difference between a buffered and an unbuffered solution. Explain the significance of a…

Q: Consider the following thermochemical equation 25O2 + O₂ → 2SO3 AH = -198.2 kJ What is the energy…

Q: I need the chemical name for this CuHPO4 HNO2 (aq) HF (aq) HSCN O2 W2O3 Ag3PO5 MgCI2

A: The given molecules are: CuHPO4, HNO2, HF, HSCN, O2, W2O3, Ag3PO4 and MgCl2 All the above molecules…

Q: Balance the following chemical equation by providing the correct coefficients. [? ]Na + ]H₂O →>>…

A: Balance the following chemical equation by providing the correct coefficients : ?Na + _H2O --->…

Q: The reaction of ozone with 2-butene leads to -10 formation of aldehyde + ketone 0 aldehyde + alcohol…

A: Here we have to determine the correct products formed by the ozonolysis of 2-butene .

Q: K/U Which of the following molecules or ions can act as an acid or a base? Write the two possible…

Q: (a) Put in order of increasing rate of substitution by NH3 in the following complexes (a)…

Q: nuclear equation for the positron emission from the Thallium-201 radioisotope.

A: Positron emssion or beta plus decay is subtype of radioactive decay in which a proton inside…

Q: The following diagrams show the chemical reaction with time: A⇌BA⇌B If AA is blue and BB is…

A: The given chemical reaction with time: A⇌BA⇌B If A is blue and B is orange.

Q: What volume of H2(g), measured at 26.0°C and 100.kPa, will be produced from 3.25g of Na(s)? 2Na(s)…

Q: Temperature C 25 °C Write the Ksp expression here: Calculate the Ksp value here (Show work): Volume…

A: The solubility product constant of a reaction is calculated by the multiplication of molarity of the…

Q: Calculate the number of ATP generated from one saturated 18-carbon fatty acid. Assume that each NADH…

A: 1 NaDH produces 2.5 ATP while 1 FADH2 produces 1.5 ATP.

Q: Three moles of each reactant are placed in a reaction vessel roduct? (75%)

Q: Determine the density of CO2 gas at STP. O 4.46 g/L O 1.96 g/L O 5.10 g/L O 2.24 g/L O 1.80 g/L

A: Determine the density of CO2 gas at STP ?

Q: 3. Which compound undergoes the fastest exchange of hydrogen for deuterium when treated with DO and…

A: The correct option is option d.

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

In an experiment, 110.0 g of iron is combined with 95.0 g of oxygen gas to
create iron (III) oxide. If you have 30.0 g of iron (III) oxide at the end, calculate
its percentage yield. Organize all your work, starting with the BCE.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

4.106 An ore sample with a mass of 670 kg contains 27.7% magnesium carbonate, MgCO3. If all of the magnesium carbonate in this ore sample is decomposed to form carbon dioxide, describe how to determine what mass of CO2 is evolved during the process.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
A 100.0-g mixture made up of NaCl03, Na2CO3, NaCl, and NaHCO3 is heated, producing 5.95 g of oxygen, 1.67 g of water, and 14.5 g of carbon dioxide. NaCl does not react under the conditions of the experiment. The equations for the reactions that take place are: 2NaClO3(s)2NaCl(s)+3O2(g)Na2CO3(s)2Na2O(s)+CO2(g)2NaHCO3(s)Na2O(s)+2CO2(g)+H2O Assuming 100% decomposition of NaClO3, Na2CO3, and NaHCO3, what is the composition of the mixture in grams?
The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain yeast enzymes to produce ethanol and carbon dioxide gas. Balance the following equation for this reaction of sucrose. C12H22O11(aq) + H2O(l) C2H5OH(aq) + CO2(g)
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
Copper reacts with nitric acid according to the following reaction. 3Cu(s)+8HNO3(aq)3Cu(NO3)2(aq)+2NO(g)+4H2O(l) If 2.40 g of Cu is added to a container with 2.00 mL of concentrated nitric acid (70% by mass HNO3; density = 1.42 g/cm3), what mass of nitrogen monoxide gas will be produced?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.