Determine the pH of each solution and classify it as acidic, basic, or neutral. (a) pOH = 8.5 (b) pOH = 4.2 (c) pOH = 1.7 (d) pOH = 7.0

Q: What is the pH of a 0.55 M solution of (CH3)3N?

A:

Q: Which is the stronger acid, NH4+ or HBrO?

A:

Q: The pH of a solution containing a [H3O+] = 3.40 x 10 negative 5 M, is:

A: pH is a scale to measure the concentration of hydrogen ions. The negative logarithm of hydrogen ion…

Q: The pH of a 0.225 M weak acid solution, HA, is 4.05, what is the K, of the acid?

A: pH = 4.05 pH = -log[H+] = 4.05 [H+] = 10-4.05          = 8.91 * 10-5 M

Q: What is the pH of a solution with a pOH of 6.7?

A: Given: pOH of the solution = 6.7

Q: In a solution, [H+] = 1.54 x 10-2 M. What is its pH and is it considered an acid or a base?

A: Given is,  [H+] = 1.54 x 10-2 M

Q: Acids have a pH of ______ to _________.

A: The pH of any compound can be calculated on the basis of the concentration of hydronium ions present…

Q: The pH of a solution is 4. Which of the following is correct? (A) The solution is basic with an [OH]…

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: Define and describe the properties of acids and bases with respect to hydrogen ions?

A: The formation of salt and water takes place when acids and bases are reacted. Some of the examples…

Q: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca1OH22?

A: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca(OH)2?

Q: What is the pH of a 0.050M solution of (CH3)3N?

A: (CH3)3N is a weak base. The Kb of (CH3)3N is 6.5 x 10-5 at 25 0C When a weak base mixed with water…

Q: The pH of a lime is 1.90. What is the [H3O*]?

A: Power of hydrogenpH value indicates the acidic and basic nature of a solution. pH ranges between 0…

Q: How is pH and pOH calculated?

A: pH describes the potential of H+ in a solution. pH is calculated using the following equation…

Q: Why does boric acid function as such a very weak monobasic acid?

A:

Q: (Q4) What is the pH of a solution if the pOH is equal to 3.15?

A: We have to determine the PH  of a solution given that POH = 3.15

Q: The odor of vinegar isdue to the presence of acetic acid.CH.COH, a weak acid Which of the following…

A: Given: Concentration of acetic acid in the solution = 1 M. And the solvent is water.

Q: The pH of a 0.0040 M solution of HNO₃ is

A: The concentration of HNO3 is 0.0040M HNO3 is a monobasic acid. So, 1 mol HNO3 after dissociation…

Q: The pOH of a basic solution is 3.91. What is [OH⁻]?

A:

Q: 2. The pH of a lime is 1.90. What is the [H3O*]?

A: pH is negative log of Proton concentration.

Q: the pH of an acid solution is 3.59. If the concentration of the acid in the solution is 0.200 mol/L,…

A: Given Concentration of the acid=0.2 mol/LpH of the acid solution=3.59Ka of thel acid=??

Q: If the pH of a solution is 6.6, the pOH is

A:

Q: Using data from Appendix D, calculate 3OH-4 and pH for each of the following solutions: (a) 0.10 M…

A:

Q: Find the pH of a 0.22 M AlCl3 (aq) solution if Ka of Al3+ is 1.2 × 10–5

A:

Q: What is the pH of a 0.0760 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: Given salt is a mixture of W.B + SA  HONH3Cl it undergo salt hydrolysis  It's  pH = 7 - 1/2(pkb +…

Q: The pH of a 0.0031 M solution of HNO, is 3

A:

Q: The pH of a lime is 1.90. What is the [H3O+]? What is the [-OH]?

A: Since the relationship between pH and  [H3O+] is  pH = -log[H3O+] and the relationship between pH…

Q: If enough HCl was added so that the concentrations of NH3 and NH4+ were 0.082 M and 0.017 M,…

A: An aqueous solution containing a mixture of weak base NH3 and its conjugate acid NH4+ leads to the…

Q: The pH of a solution is 2.55. What is the [H3O+]?

A: We know that, pH can be expressed as negative logarithm of hydrogen ion concentration or hydronium…

Q: The pH of an aqueous solution is 5, what would be the pOH of this solutions

A: pH + pOH = 14

Q: Give the Summary of Factors Determining Acid Strength ?

A: Acidic Strength: It is defined to compare how easily an acid donate proton or accept electrons

Q: Given that the pH is 10.285 What is the: [H3O+] pOH [OH-] Is it an acid or base?

A: It is given that the pH of a solution is 10.285 and the [H3O+], the pOH and [OH-] needs to be…

Q: Place the following acids in order of increasing strength: -H​3P​O​4,​ H3P​O​2​ and H3P​O​3.​…

A: We have to explain the acidity order: -H​3P​O​4,​ H3P​O​2​ and H3PO3.

Q: The pH of an aqueous solution of 0.124 M ammonium nitrate, NH4NO3 (aq), is ___________. This…

A:

Q: What is the pH if the pOH is 2?

A: Given -pOH=2 UsedFormula- pH+pOH=14

Q: What is the pH of an aqueous solution with a hydronium ion concentration of 1.75 × 10⁻⁵ M?

A: We know that, pH is the negative logarithm of hydronium ion concentration. i.e.,…

Q: For  K w, the product of [H 3O +] and [OH -] is

A: Kw is the water constant and is defined as product of hydronium ion and hydroxyl ion  Kw = [H3O+]…

Q: Calculate the pH of a solution which has a pOH of 7.2 (standard conditions)

A: Calculate the pH if pOH = 7.2

Q: Sodium hydroxide is a strong base. This means that __________. *

A:

Q: What is the pH of a 0.0380 M solution of HONH₃Cl (Kb of HONH₂ is 1.1 × 10⁻⁸)?

A: pH = 3.73

Q: Determine the pH of a 0.0400 mol / L solution of H 2 S (aq).

A: The pH of a solution can be determined by the hydrogen ion's concentration. It is the negative…

Q: If the pOH of a solution is 4.21, what is its pH?

A: pOH:- It is generally defined as the measure of hydroxide ion concentration in a solution. It is…

Q: Write the products of the reaction between the acid KHP and the base NaOH, and balance the reaction:…

A:

Q: Assuming the base completely dissociates in water, what is the pH of a 5.20 g/L solution of Ba(OH)2…

A: pH is basically the negative logarithm of concentration of H+ and it is given by the formula:…

Q: What substance(s) have a pH most similar to that of water (pH 7)?

A: Salt of strong acid and strong base have a pH similar to that of water i.e. pH = 7.

Q: The pOH for O.2 M sulfuric -2 acid solution is

A: We have 0.2 M sulfuric acid H2SO4 solution.we need to calculate the pOH of this solution.

Q: The pH of orange juice is about 3.5. What would be the pOH of orange juice?

A: Given: pH= 3.5 pOH=? It is calculated as

Q: Calculate the pH and molar concentration of H+ for the following strong acid and base: a) 1.318 M…

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.