Q: 18 1) OH- 2) H+ or OH 7 2 4 3 Br₂ CH₂l₂, Zn/Cu 15 16 14 17 17 1) 03 2) (CH3)2S H₂O, H₂SO4 1)…
A: Step 1: Last one is 18Sorry for bad writing actually the number of questions are too much I have…
Q: Write the cell notation for an electrochemical cell consisting of an anode where Cr (s) is oxidized…
A: In an electrochemical cell, oxidation occurs at the anode and reduction occurs at the cathode. In…
Q: None
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Write the cell notation for an electrochemical cell consisting of an anode where Zn (s) is oxidized…
A: In an electrochemical cell, oxidation occurs at the anode and reduction occurs at the cathode. In…
Q: Calculate the Molarity of 0.524 mol of glucose in 895 mL of solution.
A: given: Number of mol of glucose: 0.524 molSolution: 895/1000L = 0.895LFormula:Molarity = Number of…
Q: 26. How many moles of sodium hydroxide (NaOH) are required to neutralize 2.00 moles of sulfuric acid…
A:
Q: ← S $24 CHEM 107-02 Exam 1: Ju 个 X A ALEKS - Julianna Graham - Lex +…
A: Step 1:Reaction between HNO3 and NH3:Moles of HNO3= 0.4 moles. Concentration of NH3= 0.8 M.…
Q: 3) Limonene, the essence of orange, is easily hydrolyzed to create the below product. Answer the…
A:
Q: A student wishes to determine the chloride ion concentration in a water sample at 25 °C using a…
A: ### a) What is the standard cell potential for this cell in V?First, let's calculate the standard…
Q: As you know, the enolase enzyme of glycolysis utilizes an E1CB mechanism to expel hydroxide as a…
A: The image contains a biochemical explanation and a query regarding the enolase enzyme mechanism…
Q: Synthesis
A: Step 1:The reaction betweenCis2−methyl−1,3−butadiene(isoprene) and propene is a kind of…
Q: Consider the following half-reactions: Half-reaction E° (V) Ag+(aq) + e- Ag(s) 0.799V…
A: In electrochemistry, the strength of an oxidizing agent is determined by its standard reduction…
Q: X(s)|X4+ (6.83 M) || Mn 04 1 minus (0.16 M) |Mn2+ (8.44 M)|H* (0.12 M) The reduction potential for…
A: Given cell equation:X (s)| X4+(6.83M)||MnO4-(0.16M)|Mn2+(8.44M)|H+(0.12M)while representing an…
Q: Why in a laboratory practice should the determination of chromium VI be done by the…
A: The determination of chromium VI (Cr(VI)) in water using the diphenylcarbazide (DPC) method rather…
Q: (3pts) Identify the following bonds as ionic, polar covalent, or nonpolar covalent: a. O-H b. C-O c.…
A: Step 1:Ionic bond:A chemical bond occurs when one or more electrons are transferred from one less…
Q: Past paper question
A: I would be more than happy to assist you with your question. However, upon checking the attachment,…
Q: Name: t Diels-Alder Homework Section (day/time): B) which pi bond reacts? (explain) E) (given…
A:
Q: Question 32 Indicate all possible products in the following reaction. (Hint: Under these conditions…
A: Step 1: Correct answer is option 4th ) I , II
Q: Find Δ S o for the formation of 1 mole of Cu2O(s) from its elements.
A: The problem is asking us to find the standard entropy change (ΔSo) for the formation of 1 mole of…
Q: 1. The transformation can be performed using what reagents? (You only need to list the reagents) HO
A:
Q: A 3. A malonic ester synthesis (shown below) using bromoethane and 1-bromobutane as alicylating…
A:
Q: How many moles of calcium hydroxide are present in a 1.70 x 1025 formula unit sample?
A: In chemistry, a mole is a unit of measurement for the amount of a substance. It is defined as the…
Q: 3. The transformation can be performed using what? OH Ethanol HO OH Ethylene glycol
A: Step 1: Alcohol went to the process of dehydration to produce alkene.Step 2: Alkelene went to the…
Q: Fill in the missing intermediates and reagents in the scheme below 1) BH3 THF 2) NaOH/H2O2 OH H2CrO4
A: The reagents given are BH3, THF, NaOH/H2O2, OH, and H2CrO4. BH3 in THF is a reducing agent that is…
Q: 2. Name the following compounds using IUPAC nomenclature: (include R/S and E/Z designations when…
A: The IUPAC names for the given compounds are: a) For (4R, 5S)-4-bromo-3-methylcyclohexene: The…
Q: 6. (0.6 pt) Draw the mechanism using the appropriate arrows for the following reaction. OH H2SO4 +…
A:
Q: Chemistry
A: i) Solvent-solvent interactions:In an ideal solution, solvent molecules are assumed to be identical…
Q: Which one of the following salts forms a basic solution when dissolved in water (25°C)? a NaNO3 b)…
A:
Q: What type of biomolecule is glycylglycine, C4H8N2O3?
A: Glycylglycine is a dipeptide composed of two glycine residues. The molecular formula of…
Q: Explain the reaction and what product will be formed and why? ว ง (1) LDA (2) CCH₂Ph
A: Step 1: Step 2: Step 3: Step 4:
Q: state why in lab,we have to count initial reading of maleic acid at 2.0g ,and initial reading of…
A: Approach to solving the question: lab experiments and basic organic chemistry Detailed explanation:…
Q: 3. Propose products for the following reactions. HNO3 cat. H2SO4 AICI 3 iPrCl
A: Thus our answer will be:
Q: 4. If some of the calcium metal remains unreacted when you start the titration, the calcium will…
A: During the titration, you're trying to determine the amount of acid needed to neutralize the calcium…
Q: What element has a Kα line with wavelength 1.46 × 10-11 m? Show your calculations on the pdf to get…
A: We will use following relation,λ1=R(Z−1)2[n121−n121]For Kα ,…
Q: Please correct answer and don't use hend raiting
A: The equivalent temperature of -40°C in Kelvin is A substance's vapor pressure and boiling point are…
Q: Write a mechanism for the interconversion of pyranose and furanose isomers in acidic media.
A: Step 1: In this question we are asked to give the mechanism for interconversions of alpha and beta…
Q: (McQuarrie 6-44) In this problem, we'll calculate the fraction of diatomic molecules in a particular…
A: The first term, (d/dJ) ln(c), is zero because ln(c) is a constant.The second term, (d/dJ) ln(2J+1),…
Q: What is the method of standard addition? If you are not told to add the amounts of Zn standard to…
A: The method of standard addition is a type of calibration method used in analytical chemistry. It is…
Q: Predict the major products of this organic reaction: 1. LDA (-78°C) ? 2. CH3Br Some notes: • Draw…
A: Step 1: This reaction is a classic example of an enolate alkylation.LDA is a strong base commonly…
Q: 11. A 0.0900 M solution of a monoprotic acid is 11.5 percent ionized. Calculate the ionization…
A:
Q: Part 3 of 3 Identify the reagent(s) necessary for the second transformation. Select the single best…
A: Step 1:During the electrophilic addition on alkene when electrophile gets added on more substituted…
Q: Question Use the OXIDATION number method to balance the following equation in BASIC conditions. Type…
A: Step-1 Given redox reaction:PH3+I2→H3PO2−+I−(aq)Step 2: Finding out the oxidation number of each…
Q: 2. Would you expect a solution of ammonium chloride (NH_CI) to be acidic or basic when added to…
A: 2. Would you expect a solution of ammonium chloride (NH4Cl) to be acidic or basic when added to…
Q: Use curved arrows to show how electrons move in this reaction. You may need to add atoms and/or…
A: Thank you.
Q: What factors do you have to consider when differentiating the relative strength of the IMF’s in…
A: Step 1:Methanol, ethanol, propanol, and butanol are all alcohols. They contain a hydroxyl functional…
Q: None
A: First, you need to find the molar mass of manganese. The molar mass of manganese (Mn) is…
Q: 28. Draw the structure of aspartic acid at a pH of 1? At a pH of 7? At a pH of 14? a. What is the…
A:
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: Determine whether or not each metal, if coated onto iron, would prevent the corrosion of iron. A. Zn…
A: To determine if a metal coating will prevent the corrosion of iron or not, it is important to…
Q: Please don't provide handwritten solution ...
A: NAD+ (Nicotinamide adenine dinucleotide) is a coenzyme that plays a crucial role in many biochemical…
Step by step
Solved in 2 steps
- consider the following compounds: CI CH3 CH3 CH3 ICH H CH3 H. CH2CH3 H H. CH3 1 which structure represent pentane? Choose. which newman projection has an eclipsed comformation Choose. the diherdal angle in structure 3 between the methyl groups is Choose. which structure represent a trans isomer? Choose the dihedral angle in structure 1 between the methyl groups is Choose which structure represent a cis isomer? Choose cyclopentane interconverts between an envelope structure and a half chair structure reljeving some fortional strainDraw the skeletal (line-bond) structure of [C6H5SO3]-. Include all lone pairs and charges as appropriate.6. Use VSEPR to predict the geometry and bond angle for each bolded atom in the following structures. HNO₂ H₂C=CHCI CH3CCH
- Choose the condensed structure for the following line structure. CH3C(CH3)2CH₂O(CH2)4CH3 CH3CH₂C(CH3)2CHO(CH₂)4CH3 CH3CH₂C(CH3)2CH₂O(CH₂)4CH3 CH,CH CH(CH,)CH,O(CH,),CH; CH3CH₂C(CH3)2CH₂OCH(CH2)3CH3CH3-CH2-CO-CH2-CH2-CO-CH3 + 2H2Convert each molecule into a skeletal structure. a. (CH3)½CHCH,CH2CH(CH3)2 c. CH3(CH2)½C(CH3)½CH(CH3)CH(CH3)CH(Br)CH3 нн HT TH ċ-C H CH3 c-c CH2 b. CH;CH(CI)CH(OH)CH3 d. CH3-C H limonene (oil of lemon)
- Fqu_5 -. H A dihedral CAqa (o) .el B H ܠܝܢ ܐ ܠܐ ܝܐ ܒܘ ܢܵܐ 14 H H # 14 CI CI H .4 H ww + 0 ub ]8 24 3® 30 4 14 H F H HConvert each molecule into a skeletal structure. a. (CH3)2CHCH,CH;CH(CH3)2 c. CH3(CH2),C(CH3)½CH(CH3)CH(CH3)CH(Br)CH3 нн HT TH C-C H CH3 d. CH3-C C-C C-C b. CH3CH(CI)CH(OH)CH3 CH2 H limonene (oil of lemon)what is the bond-line structure for 1-bromo propane? what is the bond-line structure of trans-1,2-dibromo cyclohexane in its most stable chair form?