Choose exactly 3 answers from the choices 1. Nitrogen-containing functional groups: Amides Thiols Azo dyes Amines 2. Carbonyl-containing functional groups: Aldehydes Ethers Ketones Carboxylic acids 3. Structural components/groups present in Ethoxymethane: Methyl group Ethyl group Oxygen Ester linkage

Choose exactly 3 answers from the choices 1. Nitrogen-containing functional groups: Amides Thiols Azo dyes Amines 2. Carbonyl-containing functional groups: Aldehydes Ethers Ketones Carboxylic acids 3. Structural components/groups present in Ethoxymethane: Methyl group Ethyl group Oxygen Ester linkage

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter10: Fuels, Organic Chemicals, And Polymers

Section: Chapter Questions

Problem 47QRT

See similar textbooks

Similar questions

12. Give a reaction showing that benzoic acid behaves as an acid.
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
Functional Group Classes Alcohol Amide Ester • CH₂CH₂OH * CHIO-CH, 7. H₂C1O Amine Ketone Circle each functional group(s) and identify the class to which each of the groups belongs. 9. H₂C Aldehyde Thiol Aromatics Carboxylic Acid 2. CH,SH 6. Alkenes 4. H₂NCH₂CH₂ 10. Ether NM₂ 11. Which of the functional groups in the top list must be on a terminalC in the carbon chain?
The amines are organic weak bases which are nitrogen-containing. In the early days of organic chemistry, basic amines derived from natural sources were known as “vegetable alkali”, but they are now referred to as alkaloids. The study of alkaloids provided much of the growth of organic chemistry, phytochemistry and natural products chemistry. It remains a fascinating area of research. Please search for one naturally occurring alkaloid and provide the following: Name of the alkaloid and show its structure. Identify using arrows the polar bonds in the structure Species from where it was isolated What was the use of this alkaloid in plants (if any)? What are the pharmacological, medicinal, or environmental uses or applications of this alkaloid (if any)?
Does methanol behave as an acid or a base when it reacts with methylamine?
Define features of any carbonyl group ?
1) To identify which contains more acid vinegar or lemon juice neutralization with sodium hydroxide can be used. Explain how. 2) The long filaments making up the thread of woven synthetic fabrics are likely polyesters. Describe the special characteristic that the alcohol and carboxylic acid must have so that they can react with each other to produce such long filaments.
11. The functional groups that do not exist in the following fictitious molecular structure are listed in CHO COOH H₂C-0 OH -0 CCH NH COOMe a) Nitrile, ketone, aldehyde, amine, acid anhydride, acid chloride b) Nitrile, acid chloride, amine, acid anhydride, ketone c) Alcohol, aldehyde, amide, ether, ester, d) Carboxylic acid, aldehyde, ether, ester, amide e) Alcohol, nitrile, ether, acid chloride, ketone
Draw the structural formulas for the carboxylic acid chloride molecule used to make each of the following amides: C-NH-CH, a. CH, b. CH,CH,CH,-C-NH- CH,CH, CH, O CH, C. CH,CH-C-N-CH, CH,CH, d. CH,CH,-N-C- CH,CH, |
- A A Aa v A m、m、iv三E O Find - 三三三三m。 v田v Normal No Spacing Heading 1 x' A 2. A v Replace Dictate A Select v Paragraph Styles Editing Voice 19. Which of the following compounds will undergo oxidation using potassium dichromate to form a carboxylic acid? B a. A and B only с. В only b. A and C only d. C only 20. The reaction of which combination of reactants result in the formation of a hemiacetal? a. aldehyde and alcohol c. aldehyde and carboxylic acid b. aldehyde and amine d. aldehyde and water 21. Which of the following is true of hemiacetals? a. The most stable hemiacetals are noncyclic. b. The most stable hemiacetals have four- or five-membered rings. c. The most stable hemiacetals have five- or six-membered rings. d. The most stable hemiacetals contain no OH groups. 22. Which type of biologically important molecules includes many cyclic hemiacetals? a. carbohydrates c. Proteins b. lipids d. none of these * Accessibility: Investigate D'Focus 当 prt sc F10 home end F3 F4 F5 F6 F7 F8…
What organic functional group does terephthalic acid contain?
10 Chem101 a app.101edu.co Question 21 of 28 Submit The steroid molecule below is a metabolic precursor of both testosterone and estrone. What functional group(s) are present? A) ketone CH3 B) aldehyde CH3 C) ether D) ester E) ether and ester