Calculate the standard molar entropy of vaporization of water at 33.0 °C, given that its standard molar entropy of vaporization at 100.0 °C is 109.0 J-K-¹ mol and the molar heat capacities at constant pressure for liquid water and water vapor are 75.3 J-K-mol-¹ and 33.6 J-K--mol, respectively, in this temperature range.

Calculate the standard molar entropy of vaporization of water at 33.0 °C, given that its standard molar entropy of vaporization at 100.0 °C is 109.0 J-K-¹ mol and the molar heat capacities at constant pressure for liquid water and water vapor are 75.3 J-K-mol-¹ and 33.6 J-K--mol, respectively, in this temperature range.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 101QRT: Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this...

See similar textbooks

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
2. Which of the following is true for a spontaneous process but not for a nonspontaneous process? Energy in the universe is concentrated conserved dispersed not conserved
Define the term entropy, and give an example of a sample of matter that has zero entropy. What are the units of entropy? How do they differ from the units of enthalpy?
Natural gas is mostly CH4. When it burns, the chemical reaction is CH4 g 2O2 g CO2 g 2H2O g The H of combustion of one mole of CH4 at 25.0 C is -890.9 kJ. Calculate q, w, and U under these conditions, assuming an external pressure of 1.07 atm.
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?