Calculate the pH of a .10 M solution of formic acid (HCHO2). The Ka of formic acid is 1.8 x 10-4.

Q: Calculate the pH of water at 25°C and 75°C. The values for pKw at these temperatures are 13.99 and…

A: Pure water has an equal concentration of hydrogen ions and hydroxyl ions. The dissociation of water…

Q: Calculate the pH of 0.015 M solution of weak acid, HA (Ka=1.9×10-5) at 25 degrees Celsius    HA…

A: We have a weak acid of  0.015 M  HA. Ka = 1.9*10-5  We have to calculate the pH of Solution.

Q: The pH of a solution for which [OH-] = 1.0 x10-6 is %3D

A: pH stands for Hydrogen potentials. pH is a negative logarithm of the concentration of hydrogen ions.…

Q: What is the concentration of a weak acid if its Ka = 3.7 x 10-7 and its pOH = 11.62?

A:

Q: A 0.54 M solution of chloroacetic acid, CICH2 CO2H, has a pH of 1.57. Calculate K, for the acid. %3D

A: Given: The molarity of the solution of chloroacetic acid = 0.54 M The pH of the solution = 1.57 We…

Q: Nitrous Acid (HNO2) has a Ka value of 5.6x10–4. Calculate the pH of a solution that is 0.00298 M…

A: pH = -log[H+] For a weak acid solution: [H+] = (Ka x C)1/2 Where, C = molarity of acid

Q: In a solution, [H+] = 1.54 x 10-2 M. What is its pH and is it considered an acid or a base?

A: Given is,  [H+] = 1.54 x 10-2 M

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: Calculate the pH of a 3.12×10-3 M  solution of NaF, given that the Ka of HF = 6.80 x 10-4 at 25°C.

A:

Q: What is the pH in a 0.0320 M aqueous solution of formic acid (HCOOH)? (For HCOOH, Ka=1.8 x 10–4)

A: HCOOH is a weak organic acid. It dissociates into formate ions and hydrogen ions. The ICE table for…

Q: What is the pH of a substance with a hydrogen concentration of 3.0 x 10-12?

A:

Q: The pH of a 0.045 M Ca(OH)2 solution is: +1.3467 O +12.954 O +12.653 O -1.3467

A:

Q: Determine the pH of a 2.79 M solution of acetic acid (CH3COOH, ka=1.8x10-5)

A:

Q: What is the pH of a 0.150 M solution of acetic acid (pKa=4.75) at 25 degree celsius?

A: Given, the concentration of acetic acid =0.150 Mand pKa of acetic acid =4.75 at 25 °Cwe are asked to…

Q: Calculate the pH of a solution prepared by dissolving 0.37 mol of formic acid (HCO2H) and 0.23 mol…

A: Given, moles of formic acid = 0.37 mol  moles of Sodium formate = 0.23 mol  Volume = 1 liter As we…

Q: Calculate the pH of a 0.117 M solution of formic acid.

A:

Q: Calculate the pH of a 0.025 M solution of propanoic acid (K, = 1.3 x 10-5). 7.48 0.025 O 5.6 x 104…

A:

Q: Calculate the pH of 0.10 M (COOH)½ (aq), oxalic acid. Ka1 = 5.9 x 10-² ; Ka2 = 6.4 x 10-5.

A:

Q: Calculate the pH of a 0.20 M solution of sodium acetate (NaCH3COO) given that the Ka of acetic acid…

A:

Q: Calculate [OH ]in an aqueous solution with a pH of 4.33 at 25°C. 6.3 x 10 6 O 3.8 x 10-5 O 2.1 x 10…

A: [19.]  pH = 4.33 (given)  [H+] = 10-pH  [H+] = 10-4.33  [H+] = 4.677 × 10-5 M Hence, [OH-] = 10-14 /…

Q: 1. Methanoic acid, HCO,H, also known as formic acid, is partly responsible for the characteristic…

A:

Q: If a solution of HF 1Ka = 6.8 * 10-42 has a pH of 3.65, calculate the concentration of hydrofluoric…

A: Given data, Calculating the concentration of hydrofluoric acid.

Q: Find the pH of a 0.337 M aqueous solution of hydrofluoric acid (HF), for which Ka = 6.8 × 10–4.

A: Weak acids :-  Acids which do not undergo complete dissociation and produce very less number of H+…

Q: What is the pH of an aqueous solution of HNO3 with a concentration of 3.33 x 10-3 M? О А. 5.5 о в.…

A: Given the aqueous solution of HNO3 with a concentration of 3.33×10-3we are asked to the pH of…

Q: Calculate the pH of a 5.7 x 10 M aqueous solution of hydrobromic acid (HBr). -5

A: Given :- concentration of HBr solution = 5.7 × 10-5 M  To calculate :- pH of solution  pH =…

Q: Determine the pH of a 0.100 M solution of HC₃H₅O₂ (Ka = 1.3 × 10⁻⁵).

A: The concentration of HC3H5O2 solution is 0.100 M. In the solution, HC3H5O2 (aq) ⇔H+ (aq) + C3H5O2-…

Q: Write the products of the following acid-base reaction. CH3OH NaNH2 ?

A: The reactants given are  1) CH3OH  2) NaNH2

Q: What is the pH of a 0.0310 M solution of hydrocyanic acid, HCN (Ka = 4.9 x 10-10)?

A: Answer:- This question is answered by using the simple concept of calculation of pH of weak acid…

Q: Calculate the pH of a 0.0101 M aqueous solution of formic acid (HCOOH, Ka = 1.8E-4). pH =

A: For weak monoprotic acid ( HCOOH) : pH = 0.5 x (- log Ka - log C ) pH = 0.5 x ( - log 1.8 x 10-4 -…

Q: Calculate the pH of a 0.50 M solution of sodium formate (NaHCOO) given that the Ka of formic acid…

A: Given,  The pH of a 0.50 M solution of sodium formate (NaCOOH) is: The Ka of formic acid (HCOOH) is…

Q: What is the pH of a 0.21 M solution of methylamine

A: Given :-  Initial concentration of CH3NH2 solution = 0.21M  Kb = 4.4 × 10-4  To calculate :-  pH of…

Q: Calculate the pH of a 0.20 M solution of NH4NO3. (Kb(NH3) = 1.8 x 10)

A: Salt of Weak base and Strong acid  pH = 7 - 1/2 ( pKb  - logC )

Q: Calculate the pH of a of 0.100M KBRO solution. Ka for hypobromous acid, HBRO, is 2.0 x 10 6- 10.85…

A: Given: The concentration of the KBrO3 solution = 0.100 M The Ka for HBrO3 = 2.0 × 10-9 We have to…

Q: What is the pH of the following solution? Hydrogen sulphide is a weak acid and has a pka of 8.9 x…

A: Please be noted that the value given for H2S is Ka not pKa. Therefore, pKa(H2S)=8.9×10-8.

Q: What is the pH of a 0.15M solution of potassium nitrate? (The Ka value for nitrous acid is 4.0 x…

A: Considering the given solution to be 0.15 M potassium nitrite, we have solved further.

Q: If [H*]=1.7 x 10-3 M, what is the pH of the solution? al 2.13 b. 2.77 1.83 5.42

A: Given data is as follows: H+=1.7×10-3 M The pH of a solution can be calculated as follows: pH=-logH+…

Q: Calculate the pH of 0.0985 M CH3COOH.  MM CH3COOH : 60.05 Ka = 1.8 x 10-5

A: Given data,Molarity of CH3COOH=0.0985MMolar mass of CH3COOH=60.05g/molKa=1.8×10-5

Q: Determine the pH of a solution by adding 0.23 mole formic acid and 0.17 mole of sodium formate in…

A: Here formic acid is a weak acid and sodium formate is an salt of weak acid so they both combine to…

Q: M CH3COOH?

A:

Q: Calculate the pOH of a solution with [H+]= 1.4 x 10^-9 M Calculate the pH of a 0.050 M aqueous…

A: Here, we have to calculate the pOH of a solution with [H+]= 1.4 x 10-9 M Also, we have to calculate…

Q: Calculate the pH and pOH for the following: a. 10mg of cyanic acid (pKa=9.21) in 1L of water

A:

Q: Calculate the pH of 0.17 M propanoic acid CH3CH2COOH, found in the sample analysis of sewage water.…

A: We have CH3CH2COOH →CH3CH2COO- + H+ Concentration of propanoic = 0.17 M  Ka=1.3 x 10-5

Q: Formic acid, HCOOH, has Ka= 1.8 x 10–4. Calculate the molar concentration of H3O+ in 0.15 M HCOOH…

A: using given value of ka and concentration  use equaction- H+=cα α=kaC use this boh calculate the…

Q: What is the pH of a 0.844 M solution of hypochlorous acid (Ka 2.9 x 10-8)?

A:

Q: What is the pH of a 0.025M solution of sulfuric acid? Ka₂ = 1.2 x 10-² pH = [?]

A:

Q: Determine the pH of a 0.461 M C6H5CO2H M solution if the Ka of C6H5CO2H is 6.5 x 10-5.

A: Given,Concentration = 0.461M.Ka = 6.5×10-5Then,

Q: Calculate the pH of an NaOH solution where [OH-] = 4.6 x 10-5

A: The negative logarithm of hydrogen ion concentration is known as pH. The pH value of 7 indicates…

Q: Calculate the pH of a 0.0555 M aqueous solution of the weak base ethylamine (C2H5NH2, Kb =…

A: For C2H5NH2 ,  Kb = 4.30 × 10-4 C2H5NH2 + H2O ⇌ C2H5NH3+ + OH- Kb = [C2H5NH3+] [OH-] / [C2H5NH2]…

Environmental Pollution

Environmental pollution occurs due to some unwanted alteration in the surroundings which results in unfavorable effects on all organisms of that surrounding.