1. Draw the structure of the organic product/s when: 1. propanal reacts with ammoniacal AgNO, (Tollens' reagent) 2. 3-methylbutanal forms a cyanohydrin 3. 4-methyl-2-pentanone reacts with Grignard reagent, CH₂CH₂MgBr 4. 2-methylhexanal reacts with 2 moles of ethanol in dry acid 5. two moles of phenylacetaldehyde undergo condensation to give an aldol
Q: How many moles of Hydrogen gas will be produced if you start with 2.5 moles of Magnesium and an…
A: Given, The balanced chemical equation :- Mg + 2HCl --> MgCl2 + H2 We need to find,…
Q: 1. (a). Give the IUPAC name for each of the following compounds. Include the geometric isomer or the…
A:
Q: In the laboratory a "coffee cup" calorimeter, or constant pressure calorimeter, is frequently used…
A:
Q: Write the equilibrium expression for the following reaction: A. K = B. K = [H₂01¹ [0₂] [H₂O₂]²…
A: Answer to Question 1) According to Le Chatelier's principle, the equilibrium of a reaction tends to…
Q: 1. Predict the product/s of this reaction and draw the complete, detailed mechanism. Pay attention…
A:
Q: Predict the major product for the reaction: 1-butene + HI → product(s) CH3CHICH₂CH3 CH3CI2CH2CH3 no…
A:
Q: Calculate the pH and pOH for the following: a. 10mg of cyanic acid (pKa=9.21) in 1L of water
A:
Q: Sample 15 ppm calcium 2 10 ppm calcium and 10ppm phosphate 3 5ppm Ca, 10ppm phosphate and 1%…
A: A question based on absorption that is to be accomplished.
Q: What is the curved arrow mechanism of p-t-butyl phenol treated with acetic anhydride? Include all…
A: We have to write curved arrow mechanism of the reaction between p-t-butyl phenol and acetic…
Q: A 50.00 mL solution of 0.050 M solution of acetic acid (Ka = 1.8 x 10-5) is titrated with a 0.1000 M…
A:
Q: I am supposed to calculate standard cell potential (E°) in volts for Battery #1 . Im not sure how to…
A:
Q: Identify the type of glycosidic linkage of the colored bond. Is the trisaccharide a reducing sugar?
A: A sugar molecule is joined to another group, which may or may not be another carbohydrate, via a…
Q: 3. Write expressions for the autoionization of a. H₂O b. CH3COOH C. CH3NH₂ d. CH3OH 3
A:
Q: For the following reaction, indicate the direction of the shift (right/left, products/reactants)…
A:
Q: The following transformation can be accomplished by using. to make the product. 1) Br2, FeBr3 2)…
A: -> Aromatic compound can give electrophilic aromatic substitution reaction by replacing hydrogen…
Q: Draw the chemical structure. each the Following 2,2,4-TRIMethylpentane Cycloheptene For
A:
Q: 1) Bra, light 2) КОС(СИ) 1) SOCI 2) LIAID)
A: Bromination of alkane is regio-selective always attacks on more stable tertiary free radical…
Q: the amount of heat energy needed
A: According to the question we have, C = 2.09 j/g.⁰C T1 = –25⁰C T2 = –50⁰C m = 100 g The following…
Q: 100 80- 60 40- 20 ofreer 25 50 75 m/z 100 125 150
A: M=132, M+1=133 Relative intensity is M:M+1= 10:1 M/Z = 76,77,78 corresponds to phenyl group ( IR…
Q: Given the reaction below, which is the major product? д ABC O DEF HBr ОН ABC Br + Br DEF ОН
A:
Q: 15. SO32- Total # of Valence Electrons: Lewis Structure (show all resonance structures if…
A: we have to complete the given tables for the molecules SO32- SO42-
Q: PCl5(g)PCl3(g) + Cl2(g) The reaction above has an equilibrium constant of 0.800 at 340°C, and ΔH°r…
A:
Q: Find the amount of heat energy needed to convert 100 grams (mass) of ice (use this information to…
A:
Q: For the reaction 2N₂ (9) + O₂(g) → 2N₂O(g) AG=214 kJ and AS = -148.5 J/K at 334 K and 1 atm. This…
A: For the first reaction, we have to find whether the reaction is reactant or product favored and…
Q: Calculate the pH of a 0.50 M aqueous solution of HF. (K₂ 7.2 x 104) A. 3.6 x 10-4 B. 0.019 C. 1.7 D.…
A: Concept: We have weak acid ,which undergo weak dissociation so at equilibrium we can use the…
Q: Which of these species is aromatic? I :: II :O: III :O: IV NH₂ V
A: Aromatic compounds: are compound which has planar, cyclic, complete conjugated structure which obey…
Q: When wine spoils, ethanol is oxidized to acetic acid as oxygen from the air dissolves in the wine.…
A: The given reaction is : C2H5OH (aq) + O2 (aq) ⇌ CH3COOH (aq) + H2O (ℓ) Value of equilibrium constant…
Q: In regards to Rhydberg's equation, which transition on Hydrogen atoms would you expect to have the…
A:
Q: The following transformation can be accomplished by using. to make the product. 1) Br2, FeBr3 2)…
A: -> First of all there occur friedel craft acylation reaction. Then there occur reduction .
Q: Identify the corresponding alcohol (ROH) and carbonyl compound to produce this product: 1 eq. ROH +…
A:
Q: A compound has the following infrared spectrum. Which functional groups are present in the compound?…
A:
Q: How many electrons are present in the π molecular orbital of the allyl Anion? Zero One Two Three O…
A:
Q: the daily dose of diphenhydramine HCl for a child may be determined on the basis of 5 mg/kg of body…
A: According to the question we have:- Daily dose of diphenhydramine HCl for a child = 5 mg/Kg or…
Q: What is the 1H NMR data (chemical shift, integration, multiplicity) of p-t-butyl phenol. Label the…
A: para-tert-butyl phenol : 1H NMR data t-butyl group has 9H's which appear at around 1.30 ppm as a…
Q: Calculate the solubility at 25 °C of Zn(OH), in pure water and in a 0.0070M ZnSO4 solution. You'll…
A:
Q: Elucidate the structure of the following unknown compounds based on the given information bel…
A: Note - Since the given question is a multiple question, hence I solved first question according to…
Q: In the molecular orbital model of cyclopentadienyl cation, how many pi-electrons are in bonding…
A: Here we are required to find the number of pi electron in cyclopentadienyl cation
Q: e cyclohexyNE
A:
Q: 1. > Balance the following nuclear reactions and provide the missing "?" using appropriate notation.…
A:
Q: 4. (a) Chemical shift (8) value of CH and CH3 proton in [Al(acac);] are 1.99 and 5.47 ppm,…
A:
Q: How to prepare 4% (wt/vol) strontium chloride stock solution?
A: Concentration of strontium chloride = 4%(w/v)
Q: Determine the Ksp of PbBr2 if its molar solubility in water at 25 °C is 1.05 x 10−2 M. You can…
A: Given, The solubility of PbBr2 in water at 25 °C = 1.05 × 10-2 M. The Ksp of PbBr2 is:
Q: (a-b) (c-d) (e-f) (g-h) Î Predict the product or provide reagents needed to complete each…
A: Phthalic acid when heated releases H2O to form phthalic anhydride.
Q: For an exothermic reaction, which of the following best describes the effect of increasing the…
A: Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: 1. Briefly describe or define and give an example of a. a weak electrolyte b. an amphiprotic solvent…
A: when it is dissolved in polar solvents such as water . These types of substances are called…
Q: Briefly describe or define and give an example of d. autoprotolysis e. a strong acid f. Le…
A: Since you have posted a question with multiple sub-parts, we will solve first three sub parts for…
Q: A microwave using 18.99cm IR radiation is used to heat 18.2g water from 18.8C to 71.2C. Find the…
A: Here we have to determine the number of moles of photons required to heat 18. 2 g of water from 18.…
Q: Relative Intensity 100 80- 40 20 0 25 50 75 m/z 100 125 m 150
A: In IR spectrum- C-H streching frequency= 2925-3031cm-1 C=O at 1713 cm-1 C-H bending at…
Q: Which one of the following is the solubility product constant for Mn(OH)₂?
A:
Q: What is the structure/s of the major organic product/s for the reaction below? OH NaOH OH + major…
A: Given incomplete reaction is : What is the major product/s for the reaction ? Options are :…
Please answer items 1-5. Thanks.
Step by step
Solved in 2 steps with 2 images
- With reference to the structures of acetylsalicylic acid (aspirin) and acetaminophen (the active ingredient in Tylenol), explain why acetaminophen tablets can be stored in the medicine cabinet for years, but aspirin tablets slowly decompose over time.Safrole is a naturally occurring acetal isolated from sassafras plants. Once used as a common food additive in root beer and other beverages, it is now banned because it is carcinogenic. What compounds are formed when safrole is hydrolyzed with aqueous acid? safroleWhen trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels,at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels, at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Two reactions occur when sodium hydroxide is added to methyl salicylate. One is immediate and one only occurs with reflux over time. What type of reaction occurs immediately and with which functional group on methyl salicylate does it react? What type of reaction occurs with reflux over time and with which functional group on methyl salicylate does it react?Draw the structure for the following compounds It organic 1: 2,2 diiodo-3-pentenoic acid 2: N,N-diethylpropanamide 3: 2-pentanone 4: phenoxy benzene 5: N,N-diethylpropanamide
- Why does a substance become more soluble in a solvent with increasing temperature? Solvents are ordered by decreasing value of theirdielectric constant. In the table, which is the most polar solvent and which is the least polar? How can acetylsalicylic acid be obtained from salicylic acid?Synthetize 3-phenyl-2-propenoic acid from benzaldehyde using whatever organic/inorganic reagents are needed. 3-phenyl-2-propenoic = 3-phenylacrylic acidDraw the major organic product formed when the benzoyl chloride undergoes a reaction with sodium acetate (sodium ethanoate).